benphthalate structure
|
Common Name | benphthalate | ||
|---|---|---|---|---|
| CAS Number | 58098-09-2 | Molecular Weight | 383.43800 | |
| Density | N/A | Boiling Point | 320.5ºC at 760mmHg | |
| Molecular Formula | C22H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145ºC | |
| Name | dimethyl benzene-1,2-dicarboxylate,phenyl(piperidin-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 320.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.43800 |
| Flash Point | 145ºC |
| Exact Mass | 383.17300 |
| PSA | 72.91000 |
| LogP | 3.51040 |
| InChIKey | QEQTYKZZFDOVDC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1C(=O)OC.O=C(c1ccccc1)N1CCCCC1 |
| 1,2-Benzenedicarboxylic acid,dimethyl ester,mixt. with 1-benzoylpiperidine |
| Phthalic acid,dimethyl ester,mixt. with 1-benzoylpiperidine |
| Benphthalate |
| Benftalate |