2-(2,4-dimethoxyphenyl)-5,7-dihydroxychromen-4-one
Modify Date: 2025-12-29 22:55:48
2-(2,4-dimethoxyphenyl)-5,7-dihydroxychromen-4-one structure
|
Common Name | 2-(2,4-dimethoxyphenyl)-5,7-dihydroxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 58124-14-4 | Molecular Weight | 314.28900 | |
| Density | 1.402g/cm3 | Boiling Point | 558.8ºC at 760 mmHg | |
| Molecular Formula | C17H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6ºC | |
| Name | 2-(2,4-dimethoxyphenyl)-5,7-dihydroxychromen-4-one |
|---|
| Density | 1.402g/cm3 |
|---|---|
| Boiling Point | 558.8ºC at 760 mmHg |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.28900 |
| Flash Point | 209.6ºC |
| Exact Mass | 314.07900 |
| PSA | 89.13000 |
| LogP | 2.88840 |
| Index of Refraction | 1.645 |
| InChIKey | XXBKIZHPGZPESN-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(O)cc3o2)c(OC)c1 |
|
Name: Inhibition of human recombinant glutaminyl cyclase expressed in Escherichia coli at 1...
Source: ChEMBL
Target: Glutaminyl-peptide cyclotransferase
External Id: CHEMBL3784462
|
Total 1, Current Page 1 of 1
1