5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,8-trimethoxychromen-4-one
Modify Date: 2025-09-07 12:22:50
5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,8-trimethoxychromen-4-one structure
|
Common Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,8-trimethoxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 58130-91-9 | Molecular Weight | 390.34100 | |
| Density | 1.52g/cm3 | Boiling Point | 693.7ºC at 760mmHg | |
| Molecular Formula | C19H18O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
| Name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,8-trimethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 693.7ºC at 760mmHg |
| Molecular Formula | C19H18O9 |
| Molecular Weight | 390.34100 |
| Flash Point | 251.1ºC |
| Exact Mass | 390.09500 |
| PSA | 127.82000 |
| LogP | 2.61120 |
| Index of Refraction | 1.663 |
| InChIKey | DEQJJTUOVGHXHW-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3c(OC)c(O)c(OC)c(O)c3c(=O)c2OC)ccc1O |
|
Name: In vitro inhibitory activity against tubulin polymerization (10 uM)
Source: ChEMBL
Target: Tubulin alpha-3C chain
External Id: CHEMBL818984
|
|
Name: In vitro cytotoxic potency against NCI-60 human tumor cell line
Source: ChEMBL
Target: Panel NCI-60 (60 carcinoma cell lines)
External Id: CHEMBL749609
|
|
Name: In vitro inhibition of binding of [3H]colchicine to tubulin at 50 mM.
Source: ChEMBL
Target: Tubulin alpha-3C chain
External Id: CHEMBL820476
|
Total 3, Current Page 1 of 1
1
| 5,7,4'-Trihydroxy-3,6,8,3'-tetramethoxyflavone |