N,N'-di-[1]naphthoyl-hydrazine structure
|
Common Name | N,N'-di-[1]naphthoyl-hydrazine | ||
|---|---|---|---|---|
| CAS Number | 5814-09-5 | Molecular Weight | 340.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N'-di-[1]naphthoyl-hydrazine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H16N2O2 |
|---|---|
| Molecular Weight | 340.37500 |
| Exact Mass | 340.12100 |
| PSA | 58.20000 |
| LogP | 4.84960 |
| InChIKey | OABGSBGGPVLBEN-UHFFFAOYSA-N |
| SMILES | O=C(NNC(=O)c1cccc2ccccc12)c1cccc2ccccc12 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,2-Di( |