2,4-dinitro-1-(2-nitroethenyl)benzene structure
|
Common Name | 2,4-dinitro-1-(2-nitroethenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 5816-92-2 | Molecular Weight | 239.14200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dinitro-1-(2-nitroethenyl)benzene |
|---|
| Molecular Formula | C8H5N3O6 |
|---|---|
| Molecular Weight | 239.14200 |
| Exact Mass | 239.01800 |
| PSA | 137.46000 |
| LogP | 3.32000 |
| InChIKey | HGESYNNHMWASIC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C=Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
2,4-dinitro-1-(... CAS#:5816-92-2 |
| Literature: Devlin,C.J.; Walker,B.J. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1973 , p. 1428 - 1431 |
|
~%
2,4-dinitro-1-(... CAS#:5816-92-2 |
| Literature: Fieser; Daudt Journal of the American Chemical Society, 1946 , vol. 68, p. 2248 |