2-amino-3-(1-chloronaphthalen-2-yl)propanoic acid
Modify Date: 2025-09-18 17:45:59
2-amino-3-(1-chloronaphthalen-2-yl)propanoic acid structure
|
Common Name | 2-amino-3-(1-chloronaphthalen-2-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 58161-14-1 | Molecular Weight | 249.69300 | |
| Density | 1.36g/cm3 | Boiling Point | 439.1ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4ºC | |
| Name | 2-amino-3-(1-chloronaphthalen-2-yl)propanoic acid |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 439.1ºC at 760 mmHg |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.69300 |
| Flash Point | 219.4ºC |
| Exact Mass | 249.05600 |
| PSA | 63.32000 |
| LogP | 3.14790 |
| Index of Refraction | 1.666 |
| InChIKey | PONNGHZRDCRUDO-UHFFFAOYSA-N |
| SMILES | NC(Cc1ccc2ccccc2c1Cl)C(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |