5-[(3-methoxy-4-phenylmethoxy-phenyl)methylidene]cyclopent-2-ene-1,4-dione structure
|
Common Name | 5-[(3-methoxy-4-phenylmethoxy-phenyl)methylidene]cyclopent-2-ene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 58161-70-9 | Molecular Weight | 320.33900 | |
| Density | 1.273g/cm3 | Boiling Point | 541.3ºC at 760 mmHg | |
| Molecular Formula | C20H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240ºC | |
| Name | 2-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]cyclopent-4-ene-1,3-dione |
|---|
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 541.3ºC at 760 mmHg |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.33900 |
| Flash Point | 240ºC |
| Exact Mass | 320.10500 |
| PSA | 52.60000 |
| LogP | 3.36560 |
| Index of Refraction | 1.647 |
| InChIKey | YYPWEQGBYXJBJL-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C2C(=O)C=CC2=O)ccc1OCc1ccccc1 |
|
~%
5-[(3-methoxy-4... CAS#:58161-70-9 |
| Literature: Inayama,S. et al. Journal of Medicinal Chemistry, 1976 , vol. 19, p. 433 - 436 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |