6-(4,5-dimethoxy-2-methyl-3,6-dioxo-1-cyclohexa-1,4-dienyl)-6-oxo-hexanoic acid structure
|
Common Name | 6-(4,5-dimethoxy-2-methyl-3,6-dioxo-1-cyclohexa-1,4-dienyl)-6-oxo-hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 58185-91-4 | Molecular Weight | 310.29900 | |
| Density | 1.28g/cm3 | Boiling Point | 563.7ºC at 760 mmHg | |
| Molecular Formula | C15H18O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6ºC | |
| Name | 6-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-6-oxohexanoic acid |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 563.7ºC at 760 mmHg |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.29900 |
| Flash Point | 209.6ºC |
| Exact Mass | 310.10500 |
| PSA | 106.97000 |
| LogP | 1.17320 |
| Index of Refraction | 1.524 |
| InChIKey | NYCZXGXBAJEDRI-UHFFFAOYSA-N |
| SMILES | COC1=C(OC)C(=O)C(C(=O)CCCCC(=O)O)=C(C)C1=O |
| HS Code | 2918990090 |
|---|
|
~%
6-(4,5-dimethox... CAS#:58185-91-4 |
| Literature: Okamoto; Watanabe; Kawada; Goto; Ashida; Oda; Yajima; Imada; Morimoto Chemical and pharmaceutical bulletin, 1982 , vol. 30, # 8 p. 2797 - 2819 |
|
~%
6-(4,5-dimethox... CAS#:58185-91-4 |
| Literature: Okamoto; Watanabe; Kawada; Goto; Ashida; Oda; Yajima; Imada; Morimoto Chemical and pharmaceutical bulletin, 1982 , vol. 30, # 8 p. 2797 - 2819 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |