7,7-dimethyl-9-phenyl-9$l^C16H17OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 9-oxide structure
|
Common Name | 7,7-dimethyl-9-phenyl-9$l^C16H17OP-phosphabicyclo[4.3.0]nona-1,3,5-triene 9-oxide | ||
|---|---|---|---|---|
| CAS Number | 58191-13-2 | Molecular Weight | 256.27900 | |
| Density | 1.14g/cm3 | Boiling Point | 355.9ºC at 760 mmHg | |
| Molecular Formula | C16H17OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.1ºC | |
| Name | 3,3-dimethyl-1-phenyl-2H-phosphindole 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 355.9ºC at 760 mmHg |
| Molecular Formula | C16H17OP |
| Molecular Weight | 256.27900 |
| Flash Point | 169.1ºC |
| Exact Mass | 256.10200 |
| PSA | 26.88000 |
| LogP | 3.29170 |
| Index of Refraction | 1.584 |
| InChIKey | KQBOLPLZWQPSBT-UHFFFAOYSA-N |
| SMILES | CC1(C)CP(=O)(c2ccccc2)c2ccccc21 |
|
~%
7,7-dimethyl-9-... CAS#:58191-13-2 |
| Literature: Grayson,J.I. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1976 , p. 2556 - 2562 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Phenyl-3,3-dimethylphosphindoline-1-oxide |
| 3,3-Dimethyl-1-phenylphosphindoline |
| 3,3-dimethyl-1-phenyl-2,3-dihydro-1H-phosphindole 1-oxide |