Pyridinium,1-[2-(4-fluorophenyl)-2-oxoethyl]-, iodide (1:1) structure
|
Common Name | Pyridinium,1-[2-(4-fluorophenyl)-2-oxoethyl]-, iodide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 582-70-7 | Molecular Weight | 343.13500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11FINO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-fluorophenyl)-2-pyridin-1-ium-1-ylethanone,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11FINO |
|---|---|
| Molecular Weight | 343.13500 |
| Exact Mass | 342.98700 |
| PSA | 20.95000 |
| InChIKey | URYPODAFJVBGAH-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1)c1ccc(F)cc1.[I-] |
|
~%
Pyridinium,1-[2... CAS#:582-70-7 |
| Literature: King; McWhirter; Rowland Journal of the American Chemical Society, 1948 , vol. 70, p. 239,241 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-(4-fluoro-phenacyl)-pyridinium,iodide |
| 1-(4-Fluor-phenacyl)-pyridinium,Jodid |
| 1-(4-fluorophenyl)-2-pyridin-1-ium-1-ylethanone |