potassium 2,3,5,6-tetrachlorophenolate
potassium 2,3,5,6-tetrachlorophenolate structure
|
Common Name | potassium 2,3,5,6-tetrachlorophenolate | ||
|---|---|---|---|---|
| CAS Number | 58200-75-2 | Molecular Weight | 269.98200 | |
| Density | N/A | Boiling Point | 261ºC at 760mmHg | |
| Molecular Formula | C6HCl4KO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | potassium,2,3,5,6-tetrachlorophenolate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 261ºC at 760mmHg |
|---|---|
| Molecular Formula | C6HCl4KO |
| Molecular Weight | 269.98200 |
| Flash Point | 111.7ºC |
| Exact Mass | 267.84200 |
| PSA | 23.06000 |
| LogP | 4.44400 |
| InChIKey | QGVXBMQFCSRLHA-UHFFFAOYSA-M |
| SMILES | [K+].[O-]c1c(Cl)c(Cl)cc(Cl)c1Cl |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| EINECS 261-162-8 |
| Potassium 2,3,5,6-tetrachlorophenolate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of potassium,2,3,5,6-tetrachlorophenolate? |
| A: Molecular formula of potassium,2,3,5,6-tetrachlorophenolate is C6HCl4KO. |
| Q: What is the CAS number of potassium,2,3,5,6-tetrachlorophenolate? |
| A: CAS number of potassium,2,3,5,6-tetrachlorophenolate is 58200-75-2. |
| Q: What is the boiling point of potassium,2,3,5,6-tetrachlorophenolate? |
| A: Boiling point of potassium,2,3,5,6-tetrachlorophenolate is 261ºC at 760mmHg. |
| Q: What is the SMILES notation of potassium,2,3,5,6-tetrachlorophenolate? |
| A: SMILES notation of potassium,2,3,5,6-tetrachlorophenolate is [K+].[O-]c1c(Cl)c(Cl)cc(Cl)c1Cl. |
| Q: What is the polar surface area (PSA) of potassium,2,3,5,6-tetrachlorophenolate? |
| A: Polar surface area (PSA) of potassium,2,3,5,6-tetrachlorophenolate is 23.06000. |
| Q: What is the molecular weight of potassium,2,3,5,6-tetrachlorophenolate? |
| A: Molecular weight of potassium,2,3,5,6-tetrachlorophenolate is 269.98200. |
| Q: What is the LogP of potassium,2,3,5,6-tetrachlorophenolate? |
| A: LogP of potassium,2,3,5,6-tetrachlorophenolate is 4.44400. |
| Q: What is the Chinese name of 58200-75-2? |
| A: Chinese name of 58200-75-2 is 58200-75-2. |
| Q: What is the English name of potassium,2,3,5,6-tetrachlorophenolate? |
| A: The English name of potassium,2,3,5,6-tetrachlorophenolate is potassium,2,3,5,6-tetrachlorophenolate. |
| Q: What English synonyms does potassium,2,3,5,6-tetrachlorophenolate have? |
| A: English synonyms of potassium,2,3,5,6-tetrachlorophenolate: EINECS 261-162-8, Potassium 2,3,5,6-tetrachlorophenolate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |