alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester
Modify Date: 2026-08-24 09:37:47
alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester structure
|
Common Name | alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 58237-97-1 | Molecular Weight | 297.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO5 |
|---|---|
| Molecular Weight | 297.35 |
| InChIKey | ZPMNFPDQBCXHII-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C(NC(=O)OC(C)(C)C)c1ccco1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester? |
| A: InChIKey of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester is ZPMNFPDQBCXHII-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester? |
| A: SMILES notation of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester is CCCCOC(=O)C(NC(=O)OC(C)(C)C)c1ccco1. |
| Q: What is the molecular weight of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester? |
| A: Molecular weight of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester is 297.35. |
| Q: What is the molecular formula of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester? |
| A: Molecular formula of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester is C15H23NO5. |
| Q: What is the English name of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester? |
| A: The English name of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester is alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester. |
| Q: What is the Chinese name of 58237-97-1? |
| A: Chinese name of 58237-97-1 is 58237-97-1. |
| Q: What is the CAS number of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester? |
| A: CAS number of alpha-(N-t-Butoxycarbonylamino)furan-2-acetic acid n-butyl ester is 58237-97-1. |