Benzoic acid,4-chloro-3,5-dinitro-, 2-methylpropyl ester structure
|
Common Name | Benzoic acid,4-chloro-3,5-dinitro-, 2-methylpropyl ester | ||
|---|---|---|---|---|
| CAS Number | 58263-53-9 | Molecular Weight | 302.66800 | |
| Density | 1.421g/cm3 | Boiling Point | 406.3ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.5ºC | |
| Name | 2-methylpropyl 4-chloro-3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 406.3ºC at 760 mmHg |
| Molecular Formula | C11H11ClN2O6 |
| Molecular Weight | 302.66800 |
| Flash Point | 199.5ºC |
| Exact Mass | 302.03100 |
| PSA | 117.94000 |
| LogP | 4.01560 |
| Index of Refraction | 1.57 |
| InChIKey | MHWMKXCBVGGVSX-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Isobutyl 3,5-dinitro-4-chlorobenzoate |