N-(2-hydroxyethyl)-N-(4-methylphenyl)-4-nitrobenzenesulfonamide structure
|
Common Name | N-(2-hydroxyethyl)-N-(4-methylphenyl)-4-nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 58287-30-2 | Molecular Weight | 336.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-hydroxyethyl)-N-(4-methylphenyl)-4-nitrobenzenesulfonamide |
|---|
| Molecular Formula | C15H16N2O5S |
|---|---|
| Molecular Weight | 336.36300 |
| Exact Mass | 336.07800 |
| PSA | 111.81000 |
| LogP | 3.69480 |
| InChIKey | ARTJQZFYJGWSML-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(CCO)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
N-(2-hydroxyeth... CAS#:58287-30-2 |
| Literature: Knipe,A.C.; Lound-Keast,J. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1741 - 1748 |