3-METHYL-1,4-DIPHENYL-1H-PYRAZOL-5-AMINE structure
|
Common Name | 3-METHYL-1,4-DIPHENYL-1H-PYRAZOL-5-AMINE | ||
|---|---|---|---|---|
| CAS Number | 58314-81-1 | Molecular Weight | 249.31000 | |
| Density | 1.15g/cm3 | Boiling Point | 411.2ºC at 760 mmHg | |
| Molecular Formula | C16H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.5ºC | |
| Name | 5-methyl-2,4-diphenylpyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 411.2ºC at 760 mmHg |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.31000 |
| Flash Point | 202.5ºC |
| Exact Mass | 249.12700 |
| PSA | 43.84000 |
| LogP | 4.01110 |
| Index of Refraction | 1.635 |
| InChIKey | DMKCZUXCQWLBOI-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c(N)c1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
|
~56%
3-METHYL-1,4-DI... CAS#:58314-81-1 |
| Literature: Lv, Ting; Zhang, Xiao-Hong; Han, Jiang-Sheng; Zhong, Ping Journal of Fluorine Chemistry, 2012 , vol. 137, p. 44 - 49 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methyl-2,4-diphenyl-2H-pyrazol-3-ylamine |
| 3-Methyl-1,4-diphenyl-1H-pyrazol-5-amine |
| 3-methyl-1,4-diphenylpyrazole-5-ylamine |
| 5-Methyl-2,4-diphenyl-2H-pyrazol-3-ylamin |
| 5-amino-3-methyl-1,4-diphenylpyrazole |