4-Methyl-5-Nitro-2-Pyridinecarboxylic Acid structure
|
Common Name | 4-Methyl-5-Nitro-2-Pyridinecarboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 5832-43-9 | Molecular Weight | 182.13400 | |
| Density | 1.477g/cm3 | Boiling Point | 388.667ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.859ºC | |
| Name | 4-methyl-5-nitropyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 388.667ºC at 760 mmHg |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.13400 |
| Flash Point | 188.859ºC |
| Exact Mass | 182.03300 |
| PSA | 96.01000 |
| LogP | 1.51960 |
| Index of Refraction | 1.608 |
| InChIKey | WRCSKWMCSRGUTG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)ncc1[N+](=O)[O-] |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~95%
4-Methyl-5-Nitr... CAS#:5832-43-9 |
| Literature: Synthesis, , # 3 p. 295 - 297 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| RW1159 |
| 4-Methyl-5-nitro-2-pyridinecarboxylic acid |
| 4-Methyl-5-nitro-pyridin-2-carbonsaeure |
| 4-methyl-5-nitro-pyridine-2-carboxylic acid |
| QC-3974 |
| 4-Methyl-5-nitropicolinic acid |