(Z)-2-Nitro-1-phenyl-1-propene
(Z)-2-Nitro-1-phenyl-1-propene structure
|
Common Name | (Z)-2-Nitro-1-phenyl-1-propene | ||
|---|---|---|---|---|
| CAS Number | 58321-79-2 | Molecular Weight | 163.17300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-nitro-1-phenyl-1-propene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9NO2 |
|---|---|
| Molecular Weight | 163.17300 |
| Exact Mass | 163.06300 |
| PSA | 45.82000 |
| LogP | 2.84730 |
| InChIKey | WGSVFWFSJDAYBM-FPLPWBNLSA-N |
| SMILES | CC(=Cc1ccccc1)[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 7 | |
CAS#:103-79-7
CAS#:705-60-2
CAS#:10048-65-4
CAS#:10048-64-3
CAS#:13213-36-0
CAS#:17322-34-8
CAS#:88484-88-2This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antioxidant activity assessed as trolox equivalent of AAPH-induced peroxyl radical sc...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264721
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| β-methyl-β-nitrostyrene |
| (E)-β-methyl-β-nitrostyrene |
| trans-β-methyl-β-nitrostyrene |
| trans-β-methyl-β-nitrostyrene |
| (E)-1-phenyl-2-nitropropene |
| 1-phenyl-2-nitropropene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-nitro-1-phenyl-1-propene? |
| A: InChIKey of 2-nitro-1-phenyl-1-propene is WGSVFWFSJDAYBM-FPLPWBNLSA-N. |
| Q: What is the polar surface area (PSA) of 2-nitro-1-phenyl-1-propene? |
| A: Polar surface area (PSA) of 2-nitro-1-phenyl-1-propene is 45.82000. |
| Q: What are the downstream products of 2-nitro-1-phenyl-1-propene? |
| A: Related downstream products(CAS) of 2-nitro-1-phenyl-1-propene: 103-79-7;705-60-2;10048-65-4;10048-64-3;13213-36-0;17322-34-8;88484-88-2. |
| Q: What is the molecular weight of 2-nitro-1-phenyl-1-propene? |
| A: Molecular weight of 2-nitro-1-phenyl-1-propene is 163.17300. |
| Q: What is the molecular formula of 2-nitro-1-phenyl-1-propene? |
| A: Molecular formula of 2-nitro-1-phenyl-1-propene is C9H9NO2. |
| Q: What is the LogP of 2-nitro-1-phenyl-1-propene? |
| A: LogP of 2-nitro-1-phenyl-1-propene is 2.84730. |
| Q: What is the CAS number of 2-nitro-1-phenyl-1-propene? |
| A: CAS number of 2-nitro-1-phenyl-1-propene is 58321-79-2. |
| Q: What is the English name of 2-nitro-1-phenyl-1-propene? |
| A: The English name of 2-nitro-1-phenyl-1-propene is 2-nitro-1-phenyl-1-propene. |
| Q: What English synonyms does 2-nitro-1-phenyl-1-propene have? |
| A: English synonyms of 2-nitro-1-phenyl-1-propene: β-methyl-β-nitrostyrene, (E)-β-methyl-β-nitrostyrene, trans-β-methyl-β-nitrostyrene, trans-β-methyl-β-nitrostyrene, (E)-1-phenyl-2-nitropropene, 1-phenyl-2-nitropropene. |
| Q: What is the Chinese name of 58321-79-2? |
| A: Chinese name of 58321-79-2 is 58321-79-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |