N-(3-methoxyphenyl)-4-propoxybenzamide structure
|
Common Name | N-(3-methoxyphenyl)-4-propoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 5838-23-3 | Molecular Weight | 285.33800 | |
| Density | 1.144g/cm3 | Boiling Point | 367.7ºC at 760mmHg | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.2ºC | |
| Name | N-(3-methoxyphenyl)-4-propoxybenzamide |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 367.7ºC at 760mmHg |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.33800 |
| Flash Point | 176.2ºC |
| Exact Mass | 285.13600 |
| PSA | 47.56000 |
| LogP | 3.80930 |
| Index of Refraction | 1.584 |
| InChIKey | UYOQZGZWDKLEMD-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(C(=O)Nc2cccc(OC)c2)cc1 |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|