ethyl 3-[(2-ethoxycarbonyl-2-methyl-propyl)-(1-hydroxy-2-methyl-propan-2-yl)amino]-2,2-dimethyl-propanoate structure
|
Common Name | ethyl 3-[(2-ethoxycarbonyl-2-methyl-propyl)-(1-hydroxy-2-methyl-propan-2-yl)amino]-2,2-dimethyl-propanoate | ||
|---|---|---|---|---|
| CAS Number | 58384-41-1 | Molecular Weight | 345.47400 | |
| Density | 1.023g/cm3 | Boiling Point | 416ºC at 760 mmHg | |
| Molecular Formula | C18H35NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.4ºC | |
| Name | ethyl 3-[(3-ethoxy-2,2-dimethyl-3-oxopropyl)-(1-hydroxy-2-methylpropan-2-yl)amino]-2,2-dimethylpropanoate |
|---|
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 416ºC at 760 mmHg |
| Molecular Formula | C18H35NO5 |
| Molecular Weight | 345.47400 |
| Flash Point | 205.4ºC |
| Exact Mass | 345.25200 |
| PSA | 76.07000 |
| LogP | 2.23790 |
| Index of Refraction | 1.469 |
| InChIKey | CYZOOGYYXXQFFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)CN(CC(C)(C)C(=O)OCC)C(C)(C)CO |
|
~%
ethyl 3-[(2-eth... CAS#:58384-41-1 |
| Literature: Johnson,P.Y.; Kerkman,D.J. Journal of Organic Chemistry, 1976 , vol. 41, p. 1768 - 1773 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |