Deoxyviolacein structure
|
Common Name | Deoxyviolacein | ||
|---|---|---|---|---|
| CAS Number | 5839-61-2 | Molecular Weight | 327.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DeoxyviolaceinDeoxyviolacein is a bacterial metabolite and byproduct in the biosynthesis of the bisindole alkaloid violacein that has anticancer, antibacterial, and antifungal properties. |
| Name | Deoxyviolacein |
|---|
| Molecular Formula | C20H13N3O2 |
|---|---|
| Molecular Weight | 327.33600 |
| Exact Mass | 327.10100 |
| PSA | 73.99000 |
| LogP | 3.51130 |
| InChIKey | JHKIFAKMDLEWJK-UHFFFAOYSA-N |
| SMILES | O=C1N=c2ccccc2=C1c1cc(-c2c[nH]c3ccccc23)[nH]c1O |