1,9-Bis(2-ethoxyethyl) nonanedioate
Modify Date: 2026-04-12 09:54:29
1,9-Bis(2-ethoxyethyl) nonanedioate structure
|
Common Name | 1,9-Bis(2-ethoxyethyl) nonanedioate | ||
|---|---|---|---|---|
| CAS Number | 58394-65-3 | Molecular Weight | 332.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,9-Bis(2-ethoxyethyl) nonanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H32O6 |
|---|---|
| Molecular Weight | 332.4 |
| InChIKey | NSQBHYYAAIWZTL-UHFFFAOYSA-N |
| SMILES | CCOCCOC(=O)CCCCCCCC(=O)OCCOCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,9-Bis(2-ethoxyethyl) nonanedioate? |
| A: The English name of 1,9-Bis(2-ethoxyethyl) nonanedioate is 1,9-Bis(2-ethoxyethyl) nonanedioate. |
| Q: What is the molecular weight of 1,9-Bis(2-ethoxyethyl) nonanedioate? |
| A: Molecular weight of 1,9-Bis(2-ethoxyethyl) nonanedioate is 332.4. |
| Q: What is the CAS number of 1,9-Bis(2-ethoxyethyl) nonanedioate? |
| A: CAS number of 1,9-Bis(2-ethoxyethyl) nonanedioate is 58394-65-3. |
| Q: What is the molecular formula of 1,9-Bis(2-ethoxyethyl) nonanedioate? |
| A: Molecular formula of 1,9-Bis(2-ethoxyethyl) nonanedioate is C17H32O6. |
| Q: What is the SMILES notation of 1,9-Bis(2-ethoxyethyl) nonanedioate? |
| A: SMILES notation of 1,9-Bis(2-ethoxyethyl) nonanedioate is CCOCCOC(=O)CCCCCCCC(=O)OCCOCC. |
| Q: What is the InChIKey of 1,9-Bis(2-ethoxyethyl) nonanedioate? |
| A: InChIKey of 1,9-Bis(2-ethoxyethyl) nonanedioate is NSQBHYYAAIWZTL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 58394-65-3? |
| A: Chinese name of 58394-65-3 is 58394-65-3. |