2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide
![2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide Structure](https://image.chemsrc.com/caspic/115/5840-22-2.png)
2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide structure
|
Common Name | 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5840-22-2 | Molecular Weight | 396.43800 | |
| Density | 1.378 g/cm3 | Boiling Point | 603.7ºC at 760 mmHg | |
| Molecular Formula | C25H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.378 g/cm3 |
|---|---|
| Boiling Point | 603.7ºC at 760 mmHg |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.43800 |
| Flash Point | 318.9ºC |
| Exact Mass | 396.14700 |
| PSA | 74.35000 |
| LogP | 5.82220 |
| Index of Refraction | 1.792 |
| InChIKey | GMGDWNYWMLZUEF-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=O)c2cc3ccc4c5ccccc5[nH]c4c3cc2O)c(C)c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Tulathol AS SR |
| Naphtol AS-SRLL |
| Naphtanilide SR |
| Naphthol AS-SR |
| Amanil Naphthol AS-SR |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: CAS number of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is 5840-22-2. |
| Q: What is the molecular formula of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: Molecular formula of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is C25H20N2O3. |
| Q: What is the LogP of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: LogP of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is 5.82220. |
| Q: What is the SMILES notation of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: SMILES notation of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is COc1ccc(NC(=O)c2cc3ccc4c5ccccc5[nH]c4c3cc2O)c(C)c1. |
| Q: What English synonyms does 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide have? |
| A: English synonyms of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide: Tulathol AS SR, Naphtol AS-SRLL, Naphtanilide SR, Naphthol AS-SR, Amanil Naphthol AS-SR. |
| Q: What is the boiling point of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: Boiling point of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is 603.7ºC at 760 mmHg. |
| Q: What is the English name of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: The English name of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide. |
| Q: What is the molecular weight of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: Molecular weight of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is 396.43800. |
| Q: What is the polar surface area (PSA) of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: Polar surface area (PSA) of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is 74.35000. |
| Q: What is the InChIKey of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide? |
| A: InChIKey of 2-Hydroxy-N-(4-methoxy-2-methylphenyl)-11H-benzo[a]carbazole-3-carboxamide is GMGDWNYWMLZUEF-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |