1-benzyl-3-nitrobenzene
1-benzyl-3-nitrobenzene structure
|
Common Name | 1-benzyl-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 5840-41-5 | Molecular Weight | 213.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-benzyl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NO2 |
|---|---|
| Molecular Weight | 213.23200 |
| Exact Mass | 213.07900 |
| PSA | 45.82000 |
| LogP | 3.70880 |
| InChIKey | CMTUCQNYLNHJRT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Cc2ccccc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-nitro-diphenyl methane |
| 3-benzyl-1-nitrobenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-benzyl-3-nitrobenzene? |
| A: Molecular formula of 1-benzyl-3-nitrobenzene is C13H11NO2. |
| Q: What is the polar surface area (PSA) of 1-benzyl-3-nitrobenzene? |
| A: Polar surface area (PSA) of 1-benzyl-3-nitrobenzene is 45.82000. |
| Q: What English synonyms does 1-benzyl-3-nitrobenzene have? |
| A: English synonyms of 1-benzyl-3-nitrobenzene: 3-nitro-diphenyl methane, 3-benzyl-1-nitrobenzene. |
| Q: What is the English name of 1-benzyl-3-nitrobenzene? |
| A: The English name of 1-benzyl-3-nitrobenzene is 1-benzyl-3-nitrobenzene. |
| Q: What is the molecular weight of 1-benzyl-3-nitrobenzene? |
| A: Molecular weight of 1-benzyl-3-nitrobenzene is 213.23200. |
| Q: What is the Chinese name of 5840-41-5? |
| A: Chinese name of 5840-41-5 is 5840-41-5. |
| Q: What is the CAS number of 1-benzyl-3-nitrobenzene? |
| A: CAS number of 1-benzyl-3-nitrobenzene is 5840-41-5. |
| Q: What is the InChIKey of 1-benzyl-3-nitrobenzene? |
| A: InChIKey of 1-benzyl-3-nitrobenzene is CMTUCQNYLNHJRT-UHFFFAOYSA-N. |
| Q: What is the LogP of 1-benzyl-3-nitrobenzene? |
| A: LogP of 1-benzyl-3-nitrobenzene is 3.70880. |
| Q: What is the SMILES notation of 1-benzyl-3-nitrobenzene? |
| A: SMILES notation of 1-benzyl-3-nitrobenzene is O=[N+]([O-])c1cccc(Cc2ccccc2)c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |