[4-hydroxy-5-(hydroxymethyl)-2-methoxy-oxolan-3-yl] benzoate structure
|
Common Name | [4-hydroxy-5-(hydroxymethyl)-2-methoxy-oxolan-3-yl] benzoate | ||
|---|---|---|---|---|
| CAS Number | 58406-94-3 | Molecular Weight | 268.26300 | |
| Density | 1.34g/cm3 | Boiling Point | 448.2ºC at 760mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.7ºC | |
| Name | 4-hydroxy-5-(hydroxymethyl)-2-methoxytetrahydrofuran-3-yl benzoate |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26300 |
| Flash Point | 170.7ºC |
| Exact Mass | 268.09500 |
| PSA | 85.22000 |
| InChIKey | XMMMJMUCTUYMGE-UHFFFAOYSA-N |
| SMILES | COC1OC(CO)C(O)C1OC(=O)c1ccccc1 |
|
~%
[4-hydroxy-5-(h... CAS#:58406-94-3 |
| Literature: Schaub; Weiss Journal of the American Chemical Society, 1958 , vol. 80, p. 4683,4689 |
|
~%
[4-hydroxy-5-(h... CAS#:58406-94-3 |
| Literature: Schaub; Weiss Journal of the American Chemical Society, 1958 , vol. 80, p. 4683,4689 |
|
~%
[4-hydroxy-5-(h... CAS#:58406-94-3 |
| Literature: Schaub; Weiss Journal of the American Chemical Society, 1958 , vol. 80, p. 4683,4689 |