Dimethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate structure
|
Common Name | Dimethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 58416-04-9 | Molecular Weight | 232.210 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 378.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H8O6S | Melting Point | 182ºC | |
| MSDS | N/A | Flash Point | 182.7±26.5 °C | |
| Name | Dimethyl 3,4-Dihydroxy-2,5-thiophenedicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.6±37.0 °C at 760 mmHg |
| Melting Point | 182ºC |
| Molecular Formula | C8H8O6S |
| Molecular Weight | 232.210 |
| Flash Point | 182.7±26.5 °C |
| Exact Mass | 232.004150 |
| PSA | 121.30000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | ZZVINKJCOXPIKL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1sc(C(=O)OC)c(O)c1O |
| HS Code | 2934999090 |
|---|
|
~%
Dimethyl 3,4-di... CAS#:58416-04-9 |
| Literature: Journal of the American Chemical Society, , vol. 67, p. 2217 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Thiophenedicarboxylic acid, 3,4-dihydroxy-, dimethyl ester |
| dimethyl 3,4-dihydroxythiophene-2,5-dicarboxylate |
| Dimethyl 3,4-dihydroxy-2,5-thiophenedicarboxylate |