N-[bis(4-methylphenyl)methylidene]benzenesulfonamide structure
|
Common Name | N-[bis(4-methylphenyl)methylidene]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 58429-05-3 | Molecular Weight | 349.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[bis(4-methylphenyl)methylidene]benzenesulfonamide |
|---|
| Molecular Formula | C21H19NO2S |
|---|---|
| Molecular Weight | 349.44600 |
| Exact Mass | 349.11400 |
| PSA | 54.88000 |
| LogP | 5.61050 |
| InChIKey | FRLSFLNYOWMPMU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=NS(=O)(=O)c2ccccc2)c2ccc(C)cc2)cc1 |
|
~%
N-[bis(4-methyl... CAS#:58429-05-3 |
| Literature: Brown,C. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1978 , p. 822 - 828 |
|
~%
N-[bis(4-methyl... CAS#:58429-05-3 |
| Literature: Brown,C. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1978 , p. 822 - 828 |