D-gluco-Heptonic acid, (2xi)-, ester with boric acid (H3BO3), sodium salt structure
|
Common Name | D-gluco-Heptonic acid, (2xi)-, ester with boric acid (H3BO3), sodium salt | ||
|---|---|---|---|---|
| CAS Number | 58450-10-5 | Molecular Weight | 292.99 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H15BNaO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | D-gluco-Heptonic acid, (2xi)-, ester with boric acid (H3BO3), sodium salt |
|---|
| Molecular Formula | C7H15BNaO10 |
|---|---|
| Molecular Weight | 292.99 |
| InChIKey | KPFPZDQFKMFVRR-BMZZJELJSA-N |
| SMILES | O=C(O)C(OB(O)O)C(O)C(O)C(O)C(O)CO.[Na] |