3-[(E)-2-(4-nitrophenyl)ethenyl]pyridine structure
|
Common Name | 3-[(E)-2-(4-nitrophenyl)ethenyl]pyridine | ||
|---|---|---|---|---|
| CAS Number | 5847-74-5 | Molecular Weight | 226.23100 | |
| Density | 1.273g/cm3 | Boiling Point | 358ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.3ºC | |
| Name | 3-[2-(4-nitrophenyl)ethenyl]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 358ºC at 760 mmHg |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23100 |
| Flash Point | 170.3ºC |
| Exact Mass | 226.07400 |
| PSA | 58.71000 |
| LogP | 3.68340 |
| Index of Refraction | 1.694 |
| InChIKey | YPRDMJYMSUFTLX-ONEGZZNKSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=Cc2cccnc2)cc1 |
|
~%
3-[(E)-2-(4-nit... CAS#:5847-74-5 |
| Literature: Lewis; Kalgutkar; Yang Journal of the American Chemical Society, 2001 , vol. 123, # 17 p. 3878 - 3884 |
| trans-4'-Nitro-3-stilbazol |
| 4'-Nitro-trans-3-styrylpyridine |