14-hydroxydihydronormorphine
14-hydroxydihydronormorphine structure
|
Common Name | 14-hydroxydihydronormorphine | ||
|---|---|---|---|---|
| CAS Number | 58477-92-2 | Molecular Weight | 289.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 14-hydroxydihydronormorphine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H19NO4 |
|---|---|
| Molecular Weight | 289.32600 |
| Exact Mass | 289.13100 |
| PSA | 81.95000 |
| LogP | 0.52360 |
| InChIKey | LCJODGWVVKGCPX-DCIASYOESA-N |
| SMILES | Oc1ccc2c3c1OC1C(O)CCC4(O)C(C2)NCCC314 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:20410-95-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-a-noroxymorphol |
| α-noroxymorphinol |
| 6-α-noroxymorphol |
| 6α-noroxymorphol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 14-hydroxydihydronormorphine? |
| A: Molecular formula of 14-hydroxydihydronormorphine is C16H19NO4. |
| Q: What are the downstream products of 14-hydroxydihydronormorphine? |
| A: Related downstream products(CAS) of 14-hydroxydihydronormorphine: 20410-95-1. |
| Q: What is the molecular weight of 14-hydroxydihydronormorphine? |
| A: Molecular weight of 14-hydroxydihydronormorphine is 289.32600. |
| Q: What is the Chinese name of 58477-92-2? |
| A: Chinese name of 58477-92-2 is 58477-92-2. |
| Q: What is the InChIKey of 14-hydroxydihydronormorphine? |
| A: InChIKey of 14-hydroxydihydronormorphine is LCJODGWVVKGCPX-DCIASYOESA-N. |
| Q: What is the polar surface area (PSA) of 14-hydroxydihydronormorphine? |
| A: Polar surface area (PSA) of 14-hydroxydihydronormorphine is 81.95000. |
| Q: What is the English name of 14-hydroxydihydronormorphine? |
| A: The English name of 14-hydroxydihydronormorphine is 14-hydroxydihydronormorphine. |
| Q: What is the SMILES notation of 14-hydroxydihydronormorphine? |
| A: SMILES notation of 14-hydroxydihydronormorphine is Oc1ccc2c3c1OC1C(O)CCC4(O)C(C2)NCCC314. |
| Q: What English synonyms does 14-hydroxydihydronormorphine have? |
| A: English synonyms of 14-hydroxydihydronormorphine: 6-a-noroxymorphol, α-noroxymorphinol, 6-α-noroxymorphol, 6α-noroxymorphol. |
| Q: What is the LogP of 14-hydroxydihydronormorphine? |
| A: LogP of 14-hydroxydihydronormorphine is 0.52360. |