2-(2-methoxyphenyl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione structure
|
Common Name | 2-(2-methoxyphenyl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5848-38-4 | Molecular Weight | 388.41600 | |
| Density | 1.347g/cm3 | Boiling Point | 652.8ºC at 760 mmHg | |
| Molecular Formula | C23H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 348.6ºC | |
| Name | 2-(2-methoxyphenyl)-6-morpholin-4-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.347g/cm3 |
|---|---|
| Boiling Point | 652.8ºC at 760 mmHg |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.41600 |
| Flash Point | 348.6ºC |
| Exact Mass | 388.14200 |
| PSA | 60.77000 |
| LogP | 2.85210 |
| Index of Refraction | 1.676 |
| InChIKey | NXFORSJNVDOZAT-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1C(=O)c2cccc3c(N4CCOCC4)ccc(c23)C1=O |
|
~64%
2-(2-methoxyphe... CAS#:5848-38-4 |
| Literature: Cao, Hai-Ping; Chen, Qing-Yun Journal of Fluorine Chemistry, 2007 , vol. 128, # 10 p. 1187 - 1190 |
|
~%
2-(2-methoxyphe... CAS#:5848-38-4
Detail
|
| Literature: Hu, Chang-Ming; Qing, Feng-Ling Journal of Organic Chemistry, 1991 , vol. 56, # 22 p. 6348 - 6351 |
| 1-chloro-4-iodo-1,1,2,2,3,3,4,4-octafluorobutane |
| 4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl iodide |
| 4-chlorooctafluorobutyl iodide |
| 1-chloro-1,1,2,2,3,3,4,4-octafluoro-4-iodo-butane |