2-hydroxy-4-sulfobenzoic acid
2-hydroxy-4-sulfobenzoic acid structure
|
Common Name | 2-hydroxy-4-sulfobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 585-42-2 | Molecular Weight | 218.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-hydroxy-4-sulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H6O6S |
|---|---|
| Molecular Weight | 218.18400 |
| Exact Mass | 217.98900 |
| PSA | 120.28000 |
| LogP | 1.41790 |
| InChIKey | RHLPAVIBWYPLRV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918290000 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-hydroxy-4-sul... CAS#:585-42-2 |
| Literature: Hirwe; Jambhekar Journal of the Indian Chemical Society, 1933 , vol. 10, p. 47,48 |
|
~%
2-hydroxy-4-sul... CAS#:585-42-2 |
| Literature: Hirwe; Jambhekar Journal of the Indian Chemical Society, 1933 , vol. 10, p. 47,48 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Sulfosalicylic acid |
| Benzoic acid,2-hydroxy-4-sulfo |
| Sulfo-salicylsaeure |
| 2-Hydroxy-4-sulfo-benzoesaeure |
| 2-hydroxy-4-sulfo-benzoic acid |
| 4-sulfonyl salicylic acid |
| sulphosalicylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-hydroxy-4-sulfobenzoic acid? |
| A: Molecular weight of 2-hydroxy-4-sulfobenzoic acid is 218.18400. |
| Q: What is the Chinese name of 585-42-2? |
| A: Chinese name of 585-42-2 is 585-42-2. |
| Q: What is the SMILES notation of 2-hydroxy-4-sulfobenzoic acid? |
| A: SMILES notation of 2-hydroxy-4-sulfobenzoic acid is O=C(O)c1ccc(S(=O)(=O)O)cc1O. |
| Q: What English synonyms does 2-hydroxy-4-sulfobenzoic acid have? |
| A: English synonyms of 2-hydroxy-4-sulfobenzoic acid: 4-Sulfosalicylic acid, Benzoic acid,2-hydroxy-4-sulfo, Sulfo-salicylsaeure, 2-Hydroxy-4-sulfo-benzoesaeure, 2-hydroxy-4-sulfo-benzoic acid, 4-sulfonyl salicylic acid, sulphosalicylic acid. |
| Q: What is the InChIKey of 2-hydroxy-4-sulfobenzoic acid? |
| A: InChIKey of 2-hydroxy-4-sulfobenzoic acid is RHLPAVIBWYPLRV-UHFFFAOYSA-N. |
| Q: What is the English name of 2-hydroxy-4-sulfobenzoic acid? |
| A: The English name of 2-hydroxy-4-sulfobenzoic acid is 2-hydroxy-4-sulfobenzoic acid. |
| Q: What is the CAS number of 2-hydroxy-4-sulfobenzoic acid? |
| A: CAS number of 2-hydroxy-4-sulfobenzoic acid is 585-42-2. |
| Q: What is the molecular formula of 2-hydroxy-4-sulfobenzoic acid? |
| A: Molecular formula of 2-hydroxy-4-sulfobenzoic acid is C7H6O6S. |
| Q: What is the LogP of 2-hydroxy-4-sulfobenzoic acid? |
| A: LogP of 2-hydroxy-4-sulfobenzoic acid is 1.41790. |
| Q: What is the polar surface area (PSA) of 2-hydroxy-4-sulfobenzoic acid? |
| A: Polar surface area (PSA) of 2-hydroxy-4-sulfobenzoic acid is 120.28000. |