2-hydroxy-4-sulfobenzoic acid
Modify Date: 2025-10-19 23:29:06
2-hydroxy-4-sulfobenzoic acid structure
|
Common Name | 2-hydroxy-4-sulfobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 585-42-2 | Molecular Weight | 218.18400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-4-sulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6O6S |
|---|---|
| Molecular Weight | 218.18400 |
| Exact Mass | 217.98900 |
| PSA | 120.28000 |
| LogP | 1.41790 |
| InChIKey | RHLPAVIBWYPLRV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1O |
| HS Code | 2918290000 |
|---|
|
~%
2-hydroxy-4-sul... CAS#:585-42-2 |
| Literature: Hirwe; Jambhekar Journal of the Indian Chemical Society, 1933 , vol. 10, p. 47,48 |
|
~%
2-hydroxy-4-sul... CAS#:585-42-2 |
| Literature: Hirwe; Jambhekar Journal of the Indian Chemical Society, 1933 , vol. 10, p. 47,48 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 4-Sulfosalicylic acid |
| Benzoic acid,2-hydroxy-4-sulfo |
| Sulfo-salicylsaeure |
| 2-Hydroxy-4-sulfo-benzoesaeure |
| 2-hydroxy-4-sulfo-benzoic acid |
| 4-sulfonyl salicylic acid |
| sulphosalicylic acid |