N-(6-chloro-2-phenyl-4-pyrimidinyl)-N,N-dimethylamine structure
|
Common Name | N-(6-chloro-2-phenyl-4-pyrimidinyl)-N,N-dimethylamine | ||
|---|---|---|---|---|
| CAS Number | 58514-86-6 | Molecular Weight | 233.69700 | |
| Density | 1.222g/cm3 | Boiling Point | 288.5ºC at 760 mmHg | |
| Molecular Formula | C12H12ClN3 | Melting Point | 94-95ºC | |
| MSDS | N/A | Flash Point | 128.3ºC | |
| Name | 6-chloro-N,N-dimethyl-2-phenylpyrimidin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 288.5ºC at 760 mmHg |
| Melting Point | 94-95ºC |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.69700 |
| Flash Point | 128.3ºC |
| Exact Mass | 233.07200 |
| PSA | 29.02000 |
| LogP | 2.86300 |
| Index of Refraction | 1.609 |
| InChIKey | RWXVEFVRLTUGHU-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc(Cl)nc(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
|
~%
N-(6-chloro-2-p... CAS#:58514-86-6 |
| Literature: WO2005/95357 A2, ; Page/Page column 171 ; WO 2005/095357 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AC-0704 |
| (6-chloro-2-phenyl-pyrimidin-4-yl)-dimethyl-amine |
| 2-Phenyl-4-chlor-6-dimethylamino-pyrimidin |
| chlorophenylpyrimidinyldimethylamine |