2,2'-DICHLORO-5,5'-DIMETHOXYBENZIDINE structure
|
Common Name | 2,2'-DICHLORO-5,5'-DIMETHOXYBENZIDINE | ||
|---|---|---|---|---|
| CAS Number | 5855-70-9 | Molecular Weight | 313.17900 | |
| Density | 1.354 g/cm3 | Boiling Point | 421ºC at 760mmHg | |
| Molecular Formula | C14H14Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.4ºC | |
| Name | 4-(4-amino-2-chloro-5-methoxyphenyl)-5-chloro-2-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354 g/cm3 |
|---|---|
| Boiling Point | 421ºC at 760mmHg |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.17900 |
| Flash Point | 208.4ºC |
| Exact Mass | 312.04300 |
| PSA | 70.50000 |
| LogP | 5.00440 |
| Index of Refraction | 1.632 |
| InChIKey | NRLUQVLHGAVXQB-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(OC)c(N)cc2Cl)c(Cl)cc1N |
|
~%
2,2'-DICHLORO-5... CAS#:5855-70-9 |
| Literature: Dey; Govindachari; Rajagopalan Journal of Scientific and Industrial Research, 1946 , vol. 5 B, p. 77 |
|
~%
2,2'-DICHLORO-5... CAS#:5855-70-9 |
| Literature: Harrison Chemistry and Industry (London, United Kingdom), 1935 , p. 213 |
|
~%
2,2'-DICHLORO-5... CAS#:5855-70-9 |
| Literature: Chem.Fabr.Griesheim-Elektron Patent: DE224880 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 938 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2'-dichloro-4,4'-diamino-5,5'-dimethoxybiphenyl |
| EINECS 227-467-5 |
| 2,2'-Dichlor-5,5'-dimethoxy-benzidin |
| Dichlor-o-dianisidin |
| 3,3'-dimethoxy-6,6'-dichlorobenzidine |
| 2,2'-dichloro-5,5'-dimethoxy-benzidine |
| 6.6'-Dichlor-4.4'-diamino-3.3'-dimethoxy-diphenyl |
| 2,2'-dichloro-5,5'-dimethoxybiphenyl-4,4'-diamine |