(2E,4E)-ethyl 4-benzylidenehex-2-enoate
Modify Date: 2025-09-09 17:43:08
(2E,4E)-ethyl 4-benzylidenehex-2-enoate structure
|
Common Name | (2E,4E)-ethyl 4-benzylidenehex-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 58550-28-0 | Molecular Weight | 230.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E,4E)-ethyl 4-benzylidenehex-2-enoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18O2 |
|---|---|
| Molecular Weight | 230.30 |
| InChIKey | XBEZMXIGTPKMIB-AQASXUMVSA-N |
| SMILES | CCOC(=O)C=CC(=Cc1ccccc1)CC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2E,4E)-ethyl 4-benzylidenehex-2-enoate? |
| A: InChIKey of (2E,4E)-ethyl 4-benzylidenehex-2-enoate is XBEZMXIGTPKMIB-AQASXUMVSA-N. |
| Q: What is the English name of (2E,4E)-ethyl 4-benzylidenehex-2-enoate? |
| A: The English name of (2E,4E)-ethyl 4-benzylidenehex-2-enoate is (2E,4E)-ethyl 4-benzylidenehex-2-enoate. |
| Q: What is the CAS number of (2E,4E)-ethyl 4-benzylidenehex-2-enoate? |
| A: CAS number of (2E,4E)-ethyl 4-benzylidenehex-2-enoate is 58550-28-0. |
| Q: What is the molecular weight of (2E,4E)-ethyl 4-benzylidenehex-2-enoate? |
| A: Molecular weight of (2E,4E)-ethyl 4-benzylidenehex-2-enoate is 230.30. |
| Q: What is the Chinese name of 58550-28-0? |
| A: Chinese name of 58550-28-0 is 58550-28-0. |
| Q: What is the molecular formula of (2E,4E)-ethyl 4-benzylidenehex-2-enoate? |
| A: Molecular formula of (2E,4E)-ethyl 4-benzylidenehex-2-enoate is C15H18O2. |
| Q: What is the SMILES notation of (2E,4E)-ethyl 4-benzylidenehex-2-enoate? |
| A: SMILES notation of (2E,4E)-ethyl 4-benzylidenehex-2-enoate is CCOC(=O)C=CC(=Cc1ccccc1)CC. |