(3Z)-5-bromo-3-[2-(2-methoxyphenyl)-6-oxo[1,3]thiazolo[3,2-b][1,2,4]triazol-5(6H)-ylidene]-1-(prop-2-en-1-yl)-1,3-dihydro-2H-indol-2-one structure
|
Common Name | (3Z)-5-bromo-3-[2-(2-methoxyphenyl)-6-oxo[1,3]thiazolo[3,2-b][1,2,4]triazol-5(6H)-ylidene]-1-(prop-2-en-1-yl)-1,3-dihydro-2H-indol-2-one | ||
|---|---|---|---|---|
| CAS Number | 585555-46-0 | Molecular Weight | 495.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15BrN4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3Z)-5-bromo-3-[2-(2-methoxyphenyl)-6-oxo[1,3]thiazolo[3,2-b][1,2,4]triazol-5(6H)-ylidene]-1-(prop-2-en-1-yl)-1,3-dihydro-2H-indol-2-one |
|---|
| Molecular Formula | C22H15BrN4O3S |
|---|---|
| Molecular Weight | 495.3 |
| InChIKey | XGRNMFNNXCGCQZ-ZCXUNETKSA-N |
| SMILES | COC1=CC=CC=C1C2=NN3C(=O)/C(=C/4\C5=C(C=CC(=C5)Br)N(C4=O)CC=C)/SC3=N2 |
|
Name: Luciferase assay for modulation of the human telomerase reverse transcriptase promote...
Source: 15378
Target: N/A
External Id: TELO_01
|