N-(4-amino-m-tolyl)-N-ethylbenzamide structure
|
Common Name | N-(4-amino-m-tolyl)-N-ethylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 5856-00-8 | Molecular Weight | 254.32700 | |
| Density | 1.146 g/cm3 | Boiling Point | 455.3ºC at 760 mmHg | |
| Molecular Formula | C16H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.2ºC | |
| Name | N-(4-Amino-3-methylphenyl)-N-ethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146 g/cm3 |
|---|---|
| Boiling Point | 455.3ºC at 760 mmHg |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.32700 |
| Flash Point | 229.2ºC |
| Exact Mass | 254.14200 |
| PSA | 46.33000 |
| LogP | 3.82510 |
| Index of Refraction | 1.632 |
| InChIKey | SLYCISKABFIZAT-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)c1ccccc1)c1ccc(N)c(C)c1 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-amino-m-to... CAS#:5856-00-8 |
| Literature: DE296964 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 486 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 227-473-8 |