2-(Benzoyloxy)-2-methylpropanoic acid structure
|
Common Name | 2-(Benzoyloxy)-2-methylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 58570-00-6 | Molecular Weight | 208.21100 | |
| Density | 1.213 | Boiling Point | N/A | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzoyloxy-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213 |
|---|---|
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Exact Mass | 208.07400 |
| PSA | 63.60000 |
| LogP | 1.70660 |
| InChIKey | XGWKCHAQEYLCBD-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)c1ccccc1)C(=O)O |
| HS Code | 2918990090 |
|---|
|
~83%
2-(Benzoyloxy)-... CAS#:58570-00-6 |
| Literature: ONO PHARMACEUTICALS CO., LTD.; Kokubo, Masaya; Yano, Koji Patent: US2013/245074 A1, 2013 ; Location in patent: Paragraph 0349-0352 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(Benzoyloxy)-2-methylpropanoic acid |