p-Heptylbiphenyl-p'-carbonyl chloride
Modify Date: 2026-07-17 18:01:45
p-Heptylbiphenyl-p'-carbonyl chloride structure
|
Common Name | p-Heptylbiphenyl-p'-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 58573-87-8 | Molecular Weight | 314.84900 | |
| Density | 1.061g/cm3 | Boiling Point | 427.9ºC at 760 mmHg | |
| Molecular Formula | C20H23ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | 4-(4-heptylphenyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 427.9ºC at 760 mmHg |
| Molecular Formula | C20H23ClO |
| Molecular Weight | 314.84900 |
| Flash Point | 210.9ºC |
| Exact Mass | 314.14400 |
| PSA | 17.07000 |
| LogP | 6.24550 |
| Index of Refraction | 1.545 |
| InChIKey | WTVDKDFDBJREGM-UHFFFAOYSA-N |
| SMILES | CCCCCCCc1ccc(-c2ccc(C(=O)Cl)cc2)cc1 |
|
~97%
p-Heptylbipheny... CAS#:58573-87-8 |
| Literature: Cheung, Julie; Field, Leslie D.; Sternhell, Sever Journal of Organic Chemistry, 1997 , vol. 62, # 20 p. 7044 - 7046 |
|
~%
p-Heptylbipheny... CAS#:58573-87-8 |
| Literature: Cheung, Julie; Field, Leslie D.; Sternhell, Sever Journal of Organic Chemistry, 1997 , vol. 62, # 20 p. 7044 - 7046 |
| 4'-heptylbiphenyl-4-carbonyl chloride |
| 4'-heptylbiphenyl-4-ylcarboxylic acid chloride |
| 4-heptyl-4'-biphenylcarbonyl chloride |
| p-Heptylbiphenyl-p'-carbonyl chloride |
| [1,1'-Biphenyl]-4-carbonylchloride,4'-heptyl |
| 4'-heptyl-4-biphenylcarboxylic acid chloride |