Glycine, N-(phenylmethylene)-, phenylmethyl ester, N-oxide structure
|
Common Name | Glycine, N-(phenylmethylene)-, phenylmethyl ester, N-oxide | ||
|---|---|---|---|---|
| CAS Number | 58581-42-3 | Molecular Weight | 269.29500 | |
| Density | 1.188g/cm3 | Boiling Point | 438.3ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | N-(2-oxo-2-phenylmethoxyethyl)-1-phenylmethanimine oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 438.3ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 187.5ºC |
| Exact Mass | 269.10500 |
| PSA | 55.05000 |
| LogP | 2.88240 |
| Index of Refraction | 1.613 |
| InChIKey | MLNKMOCFRSZLSZ-UHFFFAOYSA-N |
| SMILES | O=C(C[N+]([O-])=Cc1ccccc1)OCc1ccccc1 |
| HS Code | 2925290090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| BENZYLIDENE-OXIDO-(PHENYLMETHOXYCARBONYLMETHYL)AZANIUM |
| Glycine,N-(phenylmethylene)-,phenylmethyl ester,N-oxide |