[4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate
![[4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate Structure](https://image.chemsrc.com/caspic/196/58586-46-2.png)
[4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate structure
|
Common Name | [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 58586-46-2 | Molecular Weight | 282.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14N2O3 |
|---|---|
| Molecular Weight | 282.29400 |
| Exact Mass | 282.10000 |
| PSA | 60.25000 |
| LogP | 4.20200 |
| InChIKey | JXFPPZHXLGRANI-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1ccc(N=Nc2ccc(OC)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
[4-[(4-methoxyp... CAS#:58586-46-2 |
| Literature: Moeller, Andrea; Czajka, Uta; Bergmann, Volker; Lindau, Juergen; Arnold, Manfred; Kuschel, Frank Zeitschrift fuer Chemie (Stuttgart, Germany), 1987 , vol. 27, # 6 p. 218 - 219 |
![Phenol,4-[2-(4-methoxyphenyl)diazenyl] structure](https://image.chemsrc.com/caspic/065/2496-25-5.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Propenoic acid,4-[(4-methoxyphenyl)azo]phenyl ester |
| 4-acryloyloxy-4'-methoxyazobenzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: LogP of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is 4.20200. |
| Q: What is the polar surface area (PSA) of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: Polar surface area (PSA) of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is 60.25000. |
| Q: What English synonyms does [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate have? |
| A: English synonyms of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate: 2-Propenoic acid,4-[(4-methoxyphenyl)azo]phenyl ester, 4-acryloyloxy-4'-methoxyazobenzene. |
| Q: What is the Chinese name of 58586-46-2? |
| A: Chinese name of 58586-46-2 is 58586-46-2. |
| Q: What is the SMILES notation of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: SMILES notation of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is C=CC(=O)Oc1ccc(N=Nc2ccc(OC)cc2)cc1. |
| Q: What is the molecular weight of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: Molecular weight of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is 282.29400. |
| Q: What is the InChIKey of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: InChIKey of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is JXFPPZHXLGRANI-UHFFFAOYSA-N. |
| Q: What is the CAS number of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: CAS number of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is 58586-46-2. |
| Q: What is the molecular formula of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: Molecular formula of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is C16H14N2O3. |
| Q: What is the English name of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate? |
| A: The English name of [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate is [4-[(4-methoxyphenyl)diazenyl]phenyl] prop-2-enoate. |