2-[4-[(E)-2-nitroprop-1-enyl]naphthalen-1-yl]oxyacetic acid structure
|
Common Name | 2-[4-[(E)-2-nitroprop-1-enyl]naphthalen-1-yl]oxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 58588-33-3 | Molecular Weight | 287.26700 | |
| Density | 1.353g/cm3 | Boiling Point | 524.8ºC at 760 mmHg | |
| Molecular Formula | C15H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.2ºC | |
| Name | 2-[4-[(E)-2-nitroprop-1-enyl]naphthalen-1-yl]oxyacetic acid |
|---|
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 524.8ºC at 760 mmHg |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.26700 |
| Flash Point | 271.2ºC |
| Exact Mass | 287.07900 |
| PSA | 92.35000 |
| LogP | 3.46390 |
| Index of Refraction | 1.664 |
| InChIKey | HMRFGYPCXHBBGO-CSKARUKUSA-N |
| SMILES | CC(=Cc1ccc(OCC(=O)O)c2ccccc12)[N+](=O)[O-] |
|
~%
2-[4-[(E)-2-nit... CAS#:58588-33-3 |
| Literature: Schultz; Bicking; Deana; Gould; Strobauge; Watson; Cragoe Jr. Journal of Medicinal Chemistry, 1976 , vol. 19, # 6 p. 783 - 787 |
|
~%
2-[4-[(E)-2-nit... CAS#:58588-33-3 |
| Literature: Schultz; Bicking; Deana; Gould; Strobauge; Watson; Cragoe Jr. Journal of Medicinal Chemistry, 1976 , vol. 19, # 6 p. 783 - 787 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |