(4-methoxyphenyl) 4-methylbenzoate
Modify Date: 2025-09-22 09:52:08
(4-methoxyphenyl) 4-methylbenzoate structure
|
Common Name | (4-methoxyphenyl) 4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 5859-41-6 | Molecular Weight | 242.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxyphenyl) 4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O3 |
|---|---|
| Molecular Weight | 242.27000 |
| Exact Mass | 242.09400 |
| PSA | 35.53000 |
| LogP | 3.22280 |
| InChIKey | AIAMKMCUDQZZRB-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(=O)c2ccc(C)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~93%
(4-methoxypheny... CAS#:5859-41-6 |
| Literature: Sharghi, Hashem; Jokar, Mahboubeh; Doroodmand, Mohammad Mahdi Advanced Synthesis and Catalysis, 2011 , vol. 353, # 2-3 p. 426 - 442 |
|
~79%
(4-methoxypheny... CAS#:5859-41-6 |
| Literature: Fitzjarrald, Victor P.; Pongdee, Rongson Tetrahedron Letters, 2007 , vol. 48, # 20 p. 3553 - 3557 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-methoxyphenyl-p-toluate |
| p-Toluic acid,4-methoxyphenyl ester |
| p-Toluylsaeure-<p-methoxy-phenylester> p-Methoxyphenyl-p-toluat |
| 4-methoxyphenyl 4-methylbenzoate |