5-Amino-1-hydroxy-2-naphthalenesulfonic acid
5-Amino-1-hydroxy-2-naphthalenesulfonic acid structure
|
Common Name | 5-Amino-1-hydroxy-2-naphthalenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 58596-07-9 | Molecular Weight | 239.24800 | |
| Density | 1.627g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-amino-1-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.627g/cm3 |
|---|---|
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.24800 |
| Exact Mass | 239.02500 |
| PSA | 109.00000 |
| LogP | 3.03630 |
| Index of Refraction | 1.748 |
| InChIKey | WIBJYEYYELZZGS-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c(O)c(S(=O)(=O)O)ccc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-Amino-1-hydro... CAS#:58596-07-9 |
| Literature: DE68564 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 486 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-amino-1-hydroxy-naphthalene-2-sulfonic acid |
| 5-Amino-1-hydroxy-2-naphthalenesulfonic acid |
| 1-amino-5-hydroxy-6-naphthalene-sulphonic acid |
| 5-Amino-1-hydroxy-naphthalin-2-sulfonsaeure |
| EINECS 261-354-1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: CAS number of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is 58596-07-9. |
| Q: What is the LogP of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: LogP of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is 3.03630. |
| Q: What is the English name of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: The English name of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is 5-amino-1-hydroxynaphthalene-2-sulfonic acid. |
| Q: What are the upstream materials of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: Related upstream materials(CAS) of 5-amino-1-hydroxynaphthalene-2-sulfonic acid: 83-55-6;7664-93-9. |
| Q: What English synonyms does 5-amino-1-hydroxynaphthalene-2-sulfonic acid have? |
| A: English synonyms of 5-amino-1-hydroxynaphthalene-2-sulfonic acid: 5-amino-1-hydroxy-naphthalene-2-sulfonic acid, 5-Amino-1-hydroxy-2-naphthalenesulfonic acid, 1-amino-5-hydroxy-6-naphthalene-sulphonic acid, 5-Amino-1-hydroxy-naphthalin-2-sulfonsaeure, EINECS 261-354-1. |
| Q: What is the polar surface area (PSA) of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: Polar surface area (PSA) of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is 109.00000. |
| Q: What is the InChIKey of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: InChIKey of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is WIBJYEYYELZZGS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: Molecular weight of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is 239.24800. |
| Q: What is the SMILES notation of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: SMILES notation of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is Nc1cccc2c(O)c(S(=O)(=O)O)ccc12. |
| Q: What is the molecular formula of 5-amino-1-hydroxynaphthalene-2-sulfonic acid? |
| A: Molecular formula of 5-amino-1-hydroxynaphthalene-2-sulfonic acid is C10H9NO4S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |