(2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride
Modify Date: 2025-09-02 17:23:26
(2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride structure
|
Common Name | (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 58596-64-8 | Molecular Weight | 272.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8Cl3N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H8Cl3N3S |
|---|---|
| Molecular Weight | 272.6 |
| InChIKey | DHHIAGPNHFJGNB-UHFFFAOYSA-N |
| SMILES | Cl.N=C(N)SCc1ccc(Cl)nc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride? |
| A: Molecular formula of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride is C7H8Cl3N3S. |
| Q: What is the CAS number of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride? |
| A: CAS number of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride is 58596-64-8. |
| Q: What is the SMILES notation of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride? |
| A: SMILES notation of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride is Cl.N=C(N)SCc1ccc(Cl)nc1Cl. |
| Q: What is the English name of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride? |
| A: The English name of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride is (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride. |
| Q: What is the molecular weight of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride? |
| A: Molecular weight of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride is 272.6. |
| Q: What is the Chinese name of 58596-64-8? |
| A: Chinese name of 58596-64-8 is 58596-64-8. |
| Q: What is the InChIKey of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride? |
| A: InChIKey of (2,6-Dichloropyridin-3-yl)methyl carbamimidothioate;hydrochloride is DHHIAGPNHFJGNB-UHFFFAOYSA-N. |