Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate
Modify Date: 2025-09-22 14:15:15
![Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate Structure](https://www.chemsrc.com/extcaspic/492/58596-75-1.png)
Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate structure
|
Common Name | Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 58596-75-1 | Molecular Weight | 377.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18Cl2N2O5 |
|---|---|
| Molecular Weight | 377.2 |
| InChIKey | PREJSUCNAVMGEZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(Cl)nc1Cl)(NC(C)=O)C(=O)OCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate? |
| A: CAS number of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate is 58596-75-1. |
| Q: What is the InChIKey of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate? |
| A: InChIKey of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate is PREJSUCNAVMGEZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate? |
| A: SMILES notation of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate is CCOC(=O)C(Cc1ccc(Cl)nc1Cl)(NC(C)=O)C(=O)OCC. |
| Q: What is the English name of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate? |
| A: The English name of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate is Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate. |
| Q: What is the molecular formula of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate? |
| A: Molecular formula of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate is C15H18Cl2N2O5. |
| Q: What is the molecular weight of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate? |
| A: Molecular weight of Diethyl 2-acetamido-2-[(2,6-dichloropyridin-3-yl)methyl]propanedioate is 377.2. |
| Q: What is the Chinese name of 58596-75-1? |
| A: Chinese name of 58596-75-1 is 58596-75-1. |