3-methoxy-5-nitroaniline structure
|
Common Name | 3-methoxy-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 586-10-7 | Molecular Weight | 168.15000 | |
| Density | 1.318g/cm3 | Boiling Point | 365.3ºC at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.7ºC | |
| Name | 3-methoxy-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 365.3ºC at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15000 |
| Flash Point | 174.7ºC |
| Exact Mass | 168.05300 |
| PSA | 81.07000 |
| LogP | 2.29000 |
| Index of Refraction | 1.601 |
| InChIKey | BGWUXZLHDLNYHW-UHFFFAOYSA-N |
| SMILES | COc1cc(N)cc([N+](=O)[O-])c1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-3-amino-phenol-methylaether |
| 3-methoxy-5-nitro-aniline |
| 3-Methoxy-5-nitro-anilin |
| 5-Nitro-m-anisidin |
| 3-methoxy-5-nitro-phenylamine |
| MFCD01103799 |