n-(methoxycarbonyl)-l-tryptophan methyl ester
Modify Date: 2025-08-25 10:43:34
n-(methoxycarbonyl)-l-tryptophan methyl ester structure
|
Common Name | n-(methoxycarbonyl)-l-tryptophan methyl ester | ||
|---|---|---|---|---|
| CAS Number | 58635-46-4 | Molecular Weight | 276.28800 | |
| Density | 1.273g/cm3 | Boiling Point | 494.1ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O4 | Melting Point | 99-101ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 252.6ºC | |
| Name | n-(methoxycarbonyl)-l-tryptophan methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.273g/cm3 |
|---|---|
| Boiling Point | 494.1ºC at 760 mmHg |
| Melting Point | 99-101ºC(lit.) |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.28800 |
| Flash Point | 252.6ºC |
| Exact Mass | 276.11100 |
| PSA | 80.42000 |
| LogP | 1.99890 |
| Index of Refraction | 1.595 |
| InChIKey | IYEKFSMKXYQRLC-LBPRGKRZSA-N |
| SMILES | COC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OC |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Nb-methoxycarbonyl-L-tryptophan methyl ester |
| (S)-methyl 3-(1H-indol-3-yl)-2-(methoxycarbonyl)propanoate |
| MFCD00075486 |
| N-methoxycarbonyl L-tryptophan methyl ester |