O-desmethyl Mebeverine acid structure
|
Common Name | O-desmethyl Mebeverine acid | ||
|---|---|---|---|---|
| CAS Number | 586357-02-0 | Molecular Weight | 265.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of O-desmethyl Mebeverine acidO-desmethyl Mebeverine acid is a metabolite of Mebeverine, which is a musculotropic antispasmodic drug. |
| Name | 4-[ethyl-[1-(4-hydroxyphenyl)propan-2-yl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | O-desmethyl Mebeverine acid is a metabolite of Mebeverine, which is a musculotropic antispasmodic drug. |
|---|---|
| Related Catalog |
| Molecular Formula | C15H23NO3 |
|---|---|
| Molecular Weight | 265.34800 |
| Exact Mass | 265.16800 |
| PSA | 60.77000 |
| LogP | 2.50990 |
| InChIKey | DJTCBAFIXOMULT-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(=O)O)C(C)Cc1ccc(O)cc1 |
| 4-[Ethyl[2-(4-hydroxyphenyl)-1-methylethyl]amino]butanoic Acid |
| O-Desmethyl Mebeverine Acid |
| Mebeverine metabolite O-desmethyl Mebeverine acid |