benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate
benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate structure
|
Common Name | benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate | ||
|---|---|---|---|---|
| CAS Number | 58641-56-8 | Molecular Weight | 341.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19NO5 |
|---|---|
| Molecular Weight | 341.35800 |
| Exact Mass | 341.12600 |
| PSA | 85.19000 |
| LogP | 2.81820 |
| InChIKey | DXBNGOWOMMHJKK-UHFFFAOYSA-N |
| SMILES | O=CCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzyl DL-2-(benzyloxycarbonylamino)-4-oxobutanoate |
| BENZYL 4-OXO-2-[[(PHENYLMETHOXY)CARBONYL]AMINO]BUTANOATE |
| 2-benyloxycarbonylamino-4-oxo-butyric acid benzyl ester |
| 2-BENZYLOXYCARBONYLAMINO-4-OXO-BUTYRIC ACID BENZYL ESTER |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: LogP of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is 2.81820. |
| Q: What is the CAS number of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: CAS number of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is 58641-56-8. |
| Q: What is the SMILES notation of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: SMILES notation of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is O=CCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1. |
| Q: What is the InChIKey of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: InChIKey of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is DXBNGOWOMMHJKK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: Molecular weight of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is 341.35800. |
| Q: What is the molecular formula of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: Molecular formula of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is C19H19NO5. |
| Q: What is the English name of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: The English name of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate. |
| Q: What English synonyms does benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate have? |
| A: English synonyms of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate: benzyl DL-2-(benzyloxycarbonylamino)-4-oxobutanoate, BENZYL 4-OXO-2-[[(PHENYLMETHOXY)CARBONYL]AMINO]BUTANOATE, 2-benyloxycarbonylamino-4-oxo-butyric acid benzyl ester, 2-BENZYLOXYCARBONYLAMINO-4-OXO-BUTYRIC ACID BENZYL ESTER. |
| Q: What is the Chinese name of 58641-56-8? |
| A: Chinese name of 58641-56-8 is 58641-56-8. |
| Q: What is the polar surface area (PSA) of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate? |
| A: Polar surface area (PSA) of benzyl 4-oxo-2-(phenylmethoxycarbonylamino)butanoate is 85.19000. |