2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethylpentan-3-yldisulfanyl)pentane structure
|
Common Name | 2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethylpentan-3-yldisulfanyl)pentane | ||
|---|---|---|---|---|
| CAS Number | 58712-15-5 | Molecular Weight | 318.62400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H38S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4,4-tetramethyl-3-(2,2,4,4-tetramethylpentan-3-yldisulfanyl)pentane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H38S2 |
|---|---|
| Molecular Weight | 318.62400 |
| Exact Mass | 318.24100 |
| PSA | 50.60000 |
| LogP | 7.28940 |
| InChIKey | YDEMTBDOHMUGNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(SSC(C(C)(C)C)C(C)(C)C)C(C)(C)C |
|
~%
2,2,4,4-tetrame... CAS#:58712-15-5 |
| Literature: Ohno,A. et al. Bulletin of the Chemical Society of Japan, 1975 , vol. 48, p. 3718 - 3722 |
|
~%
2,2,4,4-tetrame... CAS#:58712-15-5 |
| Literature: Buter,J.; Kellogg,R.M. Journal of Organic Chemistry, 1977 , vol. 42, # 6 p. 973 - 976 |
| Bis(1-t-butyl-2,2-dimethylpropyl)disulfid |
| Di(di-t-butyl)methyldisulfid |
| Disulfide,bis[1-(1,1-dimethylethyl)-2,2-dimethylpropyl] |
| Di<2,2,4,4-(tetramethyl)-3-pentyl>disulfid |
| bis-(1-tert-butyl-2,2-dimethyl-propyl)-disulfane |